Abafungin structure
|
Common Name | Abafungin | ||
|---|---|---|---|---|
| CAS Number | 129639-79-8 | Molecular Weight | 378.491 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 533.6±52.0 °C at 760 mmHg | |
| Molecular Formula | C21H22N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 276.5±30.7 °C | |
Use of AbafunginAbafungin, a antifungal agent, inhibitis the transmethylation at the C-24 position of the sterol side chain, catalyzed by the enzyme sterol-C-24-methyltransferase. |
| Name | abafungin |
|---|---|
| Synonym | More Synonyms |
| Description | Abafungin, a antifungal agent, inhibitis the transmethylation at the C-24 position of the sterol side chain, catalyzed by the enzyme sterol-C-24-methyltransferase. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 533.6±52.0 °C at 760 mmHg |
| Molecular Formula | C21H22N4OS |
| Molecular Weight | 378.491 |
| Flash Point | 276.5±30.7 °C |
| Exact Mass | 378.151428 |
| PSA | 86.78000 |
| LogP | 5.94 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.671 |
| InChIKey | TYBHXIFFPVFXQW-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Oc2ccccc2-c2csc(NC3=NCCCN3)n2)c(C)c1 |
| Storage condition | 2-8°C |
| N-(4-(2-((2,4-Dimethylphenyl)oxy)phenyl)-1,3-thiazol-2-yl)-1,4,5,6-tetrahydro-2-pyrimidinamine |
| 2-Pyrimidinamine, N-[4-[2-(2,4-dimethylphenoxy)phenyl]-2-thiazolyl]-1,4,5,6-tetrahydro- |
| bay w 6341 |
| Hexahydro-2-[[4-[o-(2,4-xylyloxy)phenyl]-2-thiazolyl]imino]pyrimidine |
| BAY-W 6341 |
| N-[4-[2-(2,4-Dimethylphenoxy)phenyl]-2-thiazolyl]-1,4,5,6-tetrahydro-2-pyrimidinamine |
| N-[4-[2-(2,4-dimethylphenoxy)phenyl]-1,3-thiazol-2-yl]-1,4,5,6-tetrahydropyrimidin-2-amine |
| 4-[2-(2,4-Dimethylphenoxy)phenyl]-N-(tetrahydropyrimidin-2(1H)-ylidene)-1,3-thiazol-2-amine |
| Abafungin |
| N-{4-[2-(2,4-Dimethylphenoxy)phenyl]-1,3-thiazol-2-yl}-1,4,5,6-tetrahydro-2-pyrimidinamine |