ZD7114 structure
|
Common Name | ZD7114 | ||
|---|---|---|---|---|
| CAS Number | 129689-30-1 | Molecular Weight | 454.94400 | |
| Density | 1.172g/cm3 | Boiling Point | 649.1ºC at 760mmHg | |
| Molecular Formula | C22H31ClN2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 346.4ºC | |
| Name | (S)-4-(2-hydroxy-3-phenoxypropylaminoethoxy)-N-(2-methoxyethyl)phenoxyacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.172g/cm3 |
|---|---|
| Boiling Point | 649.1ºC at 760mmHg |
| Molecular Formula | C22H31ClN2O6 |
| Molecular Weight | 454.94400 |
| Flash Point | 346.4ºC |
| Exact Mass | 454.18700 |
| PSA | 98.28000 |
| LogP | 2.82010 |
| Vapour Pressure | 9.82E-18mmHg at 25°C |
| Index of Refraction | 1.548 |
| InChIKey | RVMBDLSFFNKKLG-SFHVURJKSA-N |
| SMILES | COCCNC(=O)COc1ccc(OCCNCC(O)COc2ccccc2)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ZD 7114 HYDROCHLORIDE |
| zd7114 |
| zenecazd7114 |
| icid7114 |
| ZD7114HCl |