2,3,4,5-tetrafluoro-N-methylbenzamide
Modify Date: 2025-11-02 19:12:56
2,3,4,5-tetrafluoro-N-methylbenzamide structure
|
Common Name | 2,3,4,5-tetrafluoro-N-methylbenzamide | ||
|---|---|---|---|---|
| CAS Number | 129725-50-4 | Molecular Weight | 207.12 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H5F4NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3,4,5-tetrafluoro-N-methylbenzamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H5F4NO |
|---|---|
| Molecular Weight | 207.12 |
| InChIKey | HBTZPTYBXUXOAV-UHFFFAOYSA-N |
| SMILES | CNC(=O)c1cc(F)c(F)c(F)c1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2,3,4,5-tetrafluoro-N-methylbenzamide? |
| A: SMILES notation of 2,3,4,5-tetrafluoro-N-methylbenzamide is CNC(=O)c1cc(F)c(F)c(F)c1F. |
| Q: What is the English name of 2,3,4,5-tetrafluoro-N-methylbenzamide? |
| A: The English name of 2,3,4,5-tetrafluoro-N-methylbenzamide is 2,3,4,5-tetrafluoro-N-methylbenzamide. |
| Q: What is the molecular weight of 2,3,4,5-tetrafluoro-N-methylbenzamide? |
| A: Molecular weight of 2,3,4,5-tetrafluoro-N-methylbenzamide is 207.12. |
| Q: What is the molecular formula of 2,3,4,5-tetrafluoro-N-methylbenzamide? |
| A: Molecular formula of 2,3,4,5-tetrafluoro-N-methylbenzamide is C8H5F4NO. |
| Q: What is the InChIKey of 2,3,4,5-tetrafluoro-N-methylbenzamide? |
| A: InChIKey of 2,3,4,5-tetrafluoro-N-methylbenzamide is HBTZPTYBXUXOAV-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2,3,4,5-tetrafluoro-N-methylbenzamide? |
| A: CAS number of 2,3,4,5-tetrafluoro-N-methylbenzamide is 129725-50-4. |
| Q: What is the Chinese name of 129725-50-4? |
| A: Chinese name of 129725-50-4 is 129725-50-4. |