Benzyl ((R)-1-((1r,4R)-4-(pyridin-4-ylcarbamoyl)cyclohexyl)ethyl)carbamate
Modify Date: 2026-07-07 22:57:11
Benzyl ((R)-1-((1r,4R)-4-(pyridin-4-ylcarbamoyl)cyclohexyl)ethyl)carbamate structure
|
Common Name | Benzyl ((R)-1-((1r,4R)-4-(pyridin-4-ylcarbamoyl)cyclohexyl)ethyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 129758-07-2 | Molecular Weight | 381.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H27N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzyl ((R)-1-((1r,4R)-4-(pyridin-4-ylcarbamoyl)cyclohexyl)ethyl)carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H27N3O3 |
|---|---|
| Molecular Weight | 381.5 |
| InChIKey | QZPJWHBIGLPQAY-IPJUCJBFSA-N |
| SMILES | CC(NC(=O)OCc1ccccc1)C1CCC(C(=O)Nc2ccncc2)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Benzyl ((R)-1-((1r,4R)-4-(pyridin-4-ylcarbamoyl)cyclohexyl)ethyl)carbamate? |
| A: CAS number of Benzyl ((R)-1-((1r,4R)-4-(pyridin-4-ylcarbamoyl)cyclohexyl)ethyl)carbamate is 129758-07-2. |
| Q: What is the SMILES notation of Benzyl ((R)-1-((1r,4R)-4-(pyridin-4-ylcarbamoyl)cyclohexyl)ethyl)carbamate? |
| A: SMILES notation of Benzyl ((R)-1-((1r,4R)-4-(pyridin-4-ylcarbamoyl)cyclohexyl)ethyl)carbamate is CC(NC(=O)OCc1ccccc1)C1CCC(C(=O)Nc2ccncc2)CC1. |
| Q: What is the InChIKey of Benzyl ((R)-1-((1r,4R)-4-(pyridin-4-ylcarbamoyl)cyclohexyl)ethyl)carbamate? |
| A: InChIKey of Benzyl ((R)-1-((1r,4R)-4-(pyridin-4-ylcarbamoyl)cyclohexyl)ethyl)carbamate is QZPJWHBIGLPQAY-IPJUCJBFSA-N. |
| Q: What is the molecular weight of Benzyl ((R)-1-((1r,4R)-4-(pyridin-4-ylcarbamoyl)cyclohexyl)ethyl)carbamate? |
| A: Molecular weight of Benzyl ((R)-1-((1r,4R)-4-(pyridin-4-ylcarbamoyl)cyclohexyl)ethyl)carbamate is 381.5. |
| Q: What is the molecular formula of Benzyl ((R)-1-((1r,4R)-4-(pyridin-4-ylcarbamoyl)cyclohexyl)ethyl)carbamate? |
| A: Molecular formula of Benzyl ((R)-1-((1r,4R)-4-(pyridin-4-ylcarbamoyl)cyclohexyl)ethyl)carbamate is C22H27N3O3. |
| Q: What is the Chinese name of 129758-07-2? |
| A: Chinese name of 129758-07-2 is 129758-07-2. |
| Q: What is the English name of Benzyl ((R)-1-((1r,4R)-4-(pyridin-4-ylcarbamoyl)cyclohexyl)ethyl)carbamate? |
| A: The English name of Benzyl ((R)-1-((1r,4R)-4-(pyridin-4-ylcarbamoyl)cyclohexyl)ethyl)carbamate is Benzyl ((R)-1-((1r,4R)-4-(pyridin-4-ylcarbamoyl)cyclohexyl)ethyl)carbamate. |