Tyr-ACTH (4-9) structure
|
Common Name | Tyr-ACTH (4-9) | ||
|---|---|---|---|---|
| CAS Number | 129813-57-6 | Molecular Weight | 1068.21000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C51H65N13O11S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Tyr-ACTH (4-9)Tyr-ACTH (4-9) is a behaviorally active peptide. Tyr-ACTH (4-9) can be used for research of learned behavior extinction in the rat[1]. |
| Name | 4-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]-5-[[1-[[1-[[1-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxoprop |
|---|---|
| Synonym | More Synonyms |
| Description | Tyr-ACTH (4-9) is a behaviorally active peptide. Tyr-ACTH (4-9) can be used for research of learned behavior extinction in the rat[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C51H65N13O11S |
|---|---|
| Molecular Weight | 1068.21000 |
| Exact Mass | 1067.46000 |
| PSA | 448.06000 |
| LogP | 7.00210 |
| InChIKey | LABZPEAYQTYYEF-UHFFFAOYSA-N |
| SMILES | CSCCC(NC(=O)C(N)Cc1ccc(O)cc1)C(=O)NC(CCC(=O)O)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| WGK Germany | 3 |
|---|
| Adrenocorticotropic Hormone Tyr-Fragment 4-9 human,rat |