2-chloro-5-[(5-chlorothiophen-2-yl)disulfanyl]thiophene
![2-chloro-5-[(5-chlorothiophen-2-yl)disulfanyl]thiophene Structure](https://image.chemsrc.com/caspic/075/129836-80-2.png)
2-chloro-5-[(5-chlorothiophen-2-yl)disulfanyl]thiophene structure
|
Common Name | 2-chloro-5-[(5-chlorothiophen-2-yl)disulfanyl]thiophene | ||
|---|---|---|---|---|
| CAS Number | 129836-80-2 | Molecular Weight | 299.28300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H4Cl2S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2-Chloro-5-[(5-chlorothiophen-2-yl)disulfanyl]thiophene (CAS number: 129836-80-2, molecular formula: C8H4Cl2S4, molecular weight: 299.28300), For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-chloro-5-[(5-chlorothiophen-2-yl)disulfanyl]thiophene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H4Cl2S4 |
|---|---|
| Molecular Weight | 299.28300 |
| Exact Mass | 297.85700 |
| PSA | 107.08000 |
| LogP | 5.91580 |
| InChIKey | UIBUFCOZPVVIJZ-UHFFFAOYSA-N |
| SMILES | Clc1ccc(SSc2ccc(Cl)s2)s1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
CAS#:2404-97-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5,5'-dichloro-2,2'-dithienyl disulfide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-chloro-5-[(5-chlorothiophen-2-yl)disulfanyl]thiophene? |
| A: Molecular formula of 2-chloro-5-[(5-chlorothiophen-2-yl)disulfanyl]thiophene is C8H4Cl2S4. |
| Q: What are the upstream materials of 2-chloro-5-[(5-chlorothiophen-2-yl)disulfanyl]thiophene? |
| A: Related upstream materials(CAS) of 2-chloro-5-[(5-chlorothiophen-2-yl)disulfanyl]thiophene: 2404-97-9. |
| Q: What is the CAS number of 2-chloro-5-[(5-chlorothiophen-2-yl)disulfanyl]thiophene? |
| A: CAS number of 2-chloro-5-[(5-chlorothiophen-2-yl)disulfanyl]thiophene is 129836-80-2. |
| Q: What is the Chinese name of 129836-80-2? |
| A: Chinese name of 129836-80-2 is 129836-80-2. |
| Q: What is the SMILES notation of 2-chloro-5-[(5-chlorothiophen-2-yl)disulfanyl]thiophene? |
| A: SMILES notation of 2-chloro-5-[(5-chlorothiophen-2-yl)disulfanyl]thiophene is Clc1ccc(SSc2ccc(Cl)s2)s1. |
| Q: What is the LogP of 2-chloro-5-[(5-chlorothiophen-2-yl)disulfanyl]thiophene? |
| A: LogP of 2-chloro-5-[(5-chlorothiophen-2-yl)disulfanyl]thiophene is 5.91580. |
| Q: What English synonyms does 2-chloro-5-[(5-chlorothiophen-2-yl)disulfanyl]thiophene have? |
| A: English synonyms of 2-chloro-5-[(5-chlorothiophen-2-yl)disulfanyl]thiophene: 5,5'-dichloro-2,2'-dithienyl disulfide. |
| Q: What is the polar surface area (PSA) of 2-chloro-5-[(5-chlorothiophen-2-yl)disulfanyl]thiophene? |
| A: Polar surface area (PSA) of 2-chloro-5-[(5-chlorothiophen-2-yl)disulfanyl]thiophene is 107.08000. |
| Q: What is the InChIKey of 2-chloro-5-[(5-chlorothiophen-2-yl)disulfanyl]thiophene? |
| A: InChIKey of 2-chloro-5-[(5-chlorothiophen-2-yl)disulfanyl]thiophene is UIBUFCOZPVVIJZ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-chloro-5-[(5-chlorothiophen-2-yl)disulfanyl]thiophene? |
| A: Molecular weight of 2-chloro-5-[(5-chlorothiophen-2-yl)disulfanyl]thiophene is 299.28300. |