5,5,6,6,7,7,7-Heptafluoro-4,4-bis(trifluoromethyl)heptanoic acid structure
|
Common Name | 5,5,6,6,7,7,7-Heptafluoro-4,4-bis(trifluoromethyl)heptanoic acid | ||
|---|---|---|---|---|
| CAS Number | 129991-14-6 | Molecular Weight | 392.11400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H5F13O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5,5,6,6,7,7,7-Heptafluoro-4,4-bis(trifluoromethyl)heptanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H5F13O2 |
|---|---|
| Molecular Weight | 392.11400 |
| Exact Mass | 392.00800 |
| PSA | 37.30000 |
| LogP | 4.79510 |
| InChIKey | QOUXPUNWZRSOCX-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(C(F)(F)F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| 3-(Perfluoro-1,1-dimethylbutyl)propionic acid |
| PC9772 |
| 4,4-Bis(trifluoromethyl)-2H,2H,3H,3H-heptafluoroheptanoic acid |