Dimethyl diacetoxyfumarate structure
|
Common Name | Dimethyl diacetoxyfumarate | ||
|---|---|---|---|---|
| CAS Number | 130-84-7 | Molecular Weight | 260.19700 | |
| Density | 1.296 | Boiling Point | 322.8ºC at 760mmHg | |
| Molecular Formula | C10H12O8 | Melting Point | 102-105ºC | |
| MSDS | N/A | Flash Point | 140.1ºC | |
| Name | Dimethyl diacetoxyfumarate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.296 |
|---|---|
| Boiling Point | 322.8ºC at 760mmHg |
| Melting Point | 102-105ºC |
| Molecular Formula | C10H12O8 |
| Molecular Weight | 260.19700 |
| Flash Point | 140.1ºC |
| Exact Mass | 260.05300 |
| PSA | 105.20000 |
| Vapour Pressure | 0.000273mmHg at 25°C |
| Index of Refraction | 1.462 |
| InChIKey | NKGXGEHGPYWBDK-UHFFFAOYSA-N |
| SMILES | COC(=O)C(OC(C)=O)=C(OC(C)=O)C(=O)OC |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| HS Code | 2918990090 |
|---|
|
~%
Dimethyl diacet... CAS#:130-84-7 |
| Literature: Journal of the American Chemical Society, , vol. 76, p. 5599,5602 |
|
~72%
Dimethyl diacet... CAS#:130-84-7 |
| Literature: Jones, Eric D.; Vandegraaff, Nick; Le, Giang; Choi, Neil; Issa, William; MacFarlane, Katherine; Thienthong, Neeranat; Winfield, Lisa J.; Coates, Jonathan A.V.; Lu, Long; Li, Xinming; Feng, Xiao; Yu, Changjiang; Rhodes, David I.; Deadman, John J. Bioorganic and Medicinal Chemistry Letters, 2010 , vol. 20, # 19 p. 5913 - 5917 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| DIMETHYL (Z)-2,3-DIACETYLOXYBUT-2-ENEDIOATE |
| Diacetoxy-fumaric acid dimethyl ester |
| Fumaric acid,dihydroxy-,dimethyl ester,diacetate |
| (E)-2,3-Bis(acetyloxy)-2-butenedioic acid dimethyl ester |
| Diacetoxy-fuMaric Acid DiMethyl Ester (DAF) |
| Diacetoxy-fumarsaeure-dimethylester |
| Dihydroxyfumaric acid dimethyl ester diacetate |
| dimethyl 2,3-diacetoxyfumarate |