1,1,2,2-tetrakis(trifluoromethylsulfanyl)ethene
1,1,2,2-tetrakis(trifluoromethylsulfanyl)ethene structure
|
Common Name | 1,1,2,2-tetrakis(trifluoromethylsulfanyl)ethene | ||
|---|---|---|---|---|
| CAS Number | 13003-40-2 | Molecular Weight | 428.30500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6F12S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1,2,2-tetrakis(trifluoromethylsulfanyl)ethene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6F12S4 |
|---|---|
| Molecular Weight | 428.30500 |
| Exact Mass | 427.86900 |
| PSA | 101.20000 |
| LogP | 7.12500 |
| InChIKey | XPWHDJLYQXGXEO-UHFFFAOYSA-N |
| SMILES | FC(F)(F)SC(SC(F)(F)F)=C(SC(F)(F)F)SC(F)(F)F |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 0 | |
CAS#:463-71-8
CAS#:3872-23-9
CAS#:558-13-4
CAS#:21259-75-6
CAS#:62872-38-2
CAS#:110-54-3
CAS#:461-08-5
CAS#:142-82-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Tetrakis-trifluormethyl-mercapto-ethylen |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1,1,2,2-tetrakis(trifluoromethylsulfanyl)ethene? |
| A: The English name of 1,1,2,2-tetrakis(trifluoromethylsulfanyl)ethene is 1,1,2,2-tetrakis(trifluoromethylsulfanyl)ethene. |
| Q: What is the CAS number of 1,1,2,2-tetrakis(trifluoromethylsulfanyl)ethene? |
| A: CAS number of 1,1,2,2-tetrakis(trifluoromethylsulfanyl)ethene is 13003-40-2. |
| Q: What is the polar surface area (PSA) of 1,1,2,2-tetrakis(trifluoromethylsulfanyl)ethene? |
| A: Polar surface area (PSA) of 1,1,2,2-tetrakis(trifluoromethylsulfanyl)ethene is 101.20000. |
| Q: What are the upstream materials of 1,1,2,2-tetrakis(trifluoromethylsulfanyl)ethene? |
| A: Related upstream materials(CAS) of 1,1,2,2-tetrakis(trifluoromethylsulfanyl)ethene: 463-71-8;3872-23-9;558-13-4;21259-75-6;62872-38-2;110-54-3;461-08-5;142-82-5. |
| Q: What is the InChIKey of 1,1,2,2-tetrakis(trifluoromethylsulfanyl)ethene? |
| A: InChIKey of 1,1,2,2-tetrakis(trifluoromethylsulfanyl)ethene is XPWHDJLYQXGXEO-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1,1,2,2-tetrakis(trifluoromethylsulfanyl)ethene? |
| A: SMILES notation of 1,1,2,2-tetrakis(trifluoromethylsulfanyl)ethene is FC(F)(F)SC(SC(F)(F)F)=C(SC(F)(F)F)SC(F)(F)F. |
| Q: What is the Chinese name of 13003-40-2? |
| A: Chinese name of 13003-40-2 is 13003-40-2. |
| Q: What English synonyms does 1,1,2,2-tetrakis(trifluoromethylsulfanyl)ethene have? |
| A: English synonyms of 1,1,2,2-tetrakis(trifluoromethylsulfanyl)ethene: Tetrakis-trifluormethyl-mercapto-ethylen. |
| Q: What is the molecular weight of 1,1,2,2-tetrakis(trifluoromethylsulfanyl)ethene? |
| A: Molecular weight of 1,1,2,2-tetrakis(trifluoromethylsulfanyl)ethene is 428.30500. |
| Q: What is the molecular formula of 1,1,2,2-tetrakis(trifluoromethylsulfanyl)ethene? |
| A: Molecular formula of 1,1,2,2-tetrakis(trifluoromethylsulfanyl)ethene is C6F12S4. |