Dihydroxyazane oxide compound with hydrazino-N-phenylmethanediamine (1:1) structure
|
Common Name | Dihydroxyazane oxide compound with hydrazino-N-phenylmethanediamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 130066-22-7 | Molecular Weight | 215.21000 | |
| Density | N/A | Boiling Point | 385.9ºC at 760 mmHg | |
| Molecular Formula | C7H13N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.9ºC | |
| Name | 1-Amino-3-phenyl-guanidine, nitric acid salt |
|---|
| Boiling Point | 385.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C7H13N5O3 |
| Molecular Weight | 215.21000 |
| Flash Point | 220.9ºC |
| Exact Mass | 215.10200 |
| PSA | 142.15000 |
| LogP | 1.84410 |
| Vapour Pressure | 3.68E-06mmHg at 25°C |
| InChIKey | QLFBLPKXJZBFGN-UHFFFAOYSA-N |
| SMILES | NNC(N)Nc1ccccc1.O=[N+]([O-])O |