2-(3,5-dibromo-4-hydroxyphenoxy)acetic acid structure
|
Common Name | 2-(3,5-dibromo-4-hydroxyphenoxy)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 13012-94-7 | Molecular Weight | 325.93900 | |
| Density | 2.097g/cm3 | Boiling Point | 374ºC at 760mmHg | |
| Molecular Formula | C8H6Br2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180ºC | |
| Name | 2-(3,5-dibromo-4-hydroxyphenoxy)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 2.097g/cm3 |
|---|---|
| Boiling Point | 374ºC at 760mmHg |
| Molecular Formula | C8H6Br2O4 |
| Molecular Weight | 325.93900 |
| Flash Point | 180ºC |
| Exact Mass | 323.86300 |
| PSA | 66.76000 |
| LogP | 2.38060 |
| Vapour Pressure | 2.94E-06mmHg at 25°C |
| Index of Refraction | 1.645 |
| InChIKey | QGTZHPLLOLDFON-UHFFFAOYSA-N |
| SMILES | O=C(O)COc1cc(Br)c(O)c(Br)c1 |
| HS Code | 2918990090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3,5-Dibromo-4-hydroxyphenoxyessigsaeure |
| 3,5-Dibrom-4-hydroxy-phenoxyessigsaeure |
| Acetic acid,2-(3,5-dibromo-4-hydroxyphenoxy) |
| 3,5-DIBROMO-4-HYDROXYPHENOXYACETIC ACID |