Methyl 4-{4-[Bis(2-Hydroxyethyl)Amino]Phenyl}Butanoate
Modify Date: 2025-09-10 14:19:57
![Methyl 4-{4-[Bis(2-Hydroxyethyl)Amino]Phenyl}Butanoate Structure](https://image.chemsrc.com/caspic/165/130198-76-4.png)
Methyl 4-{4-[Bis(2-Hydroxyethyl)Amino]Phenyl}Butanoate structure
|
Common Name | Methyl 4-{4-[Bis(2-Hydroxyethyl)Amino]Phenyl}Butanoate | ||
|---|---|---|---|---|
| CAS Number | 130198-76-4 | Molecular Weight | 281.34700 | |
| Density | 1.166g/cm3 | Boiling Point | 457.1ºC at 760 mmHg | |
| Molecular Formula | C15H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.3ºC | |
| Name | methyl 4-[4-[bis(2-hydroxyethyl)amino]phenyl]butanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.166g/cm3 |
|---|---|
| Boiling Point | 457.1ºC at 760 mmHg |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.34700 |
| Flash Point | 230.3ºC |
| Exact Mass | 281.16300 |
| PSA | 70.00000 |
| LogP | 0.97330 |
| Vapour Pressure | 3.77E-09mmHg at 25°C |
| Index of Refraction | 1.56 |
| InChIKey | KCFBCMRTIRHVAE-UHFFFAOYSA-N |
| SMILES | COC(=O)CCCc1ccc(N(CCO)CCO)cc1 |
| HS Code | 2922509090 |
|---|
CAS#:75-21-8
CAS#:20637-09-6
CAS#:20637-02-9![N-[3-[4-[bis(2-chloroethyl)amino]phenyl]propyl]acridin-9-amine structure](https://image.chemsrc.com/caspic/062/130031-42-4.png)
CAS#:130031-42-4
CAS#:79481-83-7
CAS#:90393-37-6| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| methyl 4-{4-[bis(2-hydroxyethyl)amino]phenyl}butyrate |
| Methyl 4-(4-(bis(2-hydroxyethyl)amino)phenyl)butanoate |
| methyl 4-(4-(bis(2-hydroethyl)amino)phenyl)butyarte |
| methyl 3-<4-<N,N-bis(2-hydroxyethyl)amino>phenyl>butyrate |
| Methyl 4-{4-[Bis(2-Hydroxyethyl)Amino]Phenyl}Butanoate |