4(3H)-Pyrimidinone, 2-[[1-methyl-2-oxo-2-(1-piperazinyl)ethyl]thio]-6-propyl
Modify Date: 2026-07-28 08:11:31
![4(3H)-Pyrimidinone, 2-[[1-methyl-2-oxo-2-(1-piperazinyl)ethyl]thio]-6-propyl Structure](https://www.chemsrc.com/extcaspic/202/1303889-67-9.png)
4(3H)-Pyrimidinone, 2-[[1-methyl-2-oxo-2-(1-piperazinyl)ethyl]thio]-6-propyl structure
|
Common Name | 4(3H)-Pyrimidinone, 2-[[1-methyl-2-oxo-2-(1-piperazinyl)ethyl]thio]-6-propyl | ||
|---|---|---|---|---|
| CAS Number | 1303889-67-9 | Molecular Weight | 310.42 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H22N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4(3H)-Pyrimidinone, 2-[[1-methyl-2-oxo-2-(1-piperazinyl)ethyl]thio]-6-propyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H22N4O2S |
|---|---|
| Molecular Weight | 310.42 |
| InChIKey | YCTATHYRMQKMIY-UHFFFAOYSA-N |
| SMILES | CCCc1cc(=O)[nH]c(SC(C)C(=O)N2CCNCC2)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4(3H)-Pyrimidinone, 2-[[1-methyl-2-oxo-2-(1-piperazinyl)ethyl]thio]-6-propyl? |
| A: Molecular weight of 4(3H)-Pyrimidinone, 2-[[1-methyl-2-oxo-2-(1-piperazinyl)ethyl]thio]-6-propyl is 310.42. |
| Q: What is the InChIKey of 4(3H)-Pyrimidinone, 2-[[1-methyl-2-oxo-2-(1-piperazinyl)ethyl]thio]-6-propyl? |
| A: InChIKey of 4(3H)-Pyrimidinone, 2-[[1-methyl-2-oxo-2-(1-piperazinyl)ethyl]thio]-6-propyl is YCTATHYRMQKMIY-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1303889-67-9? |
| A: Chinese name of 1303889-67-9 is 1303889-67-9. |
| Q: What is the CAS number of 4(3H)-Pyrimidinone, 2-[[1-methyl-2-oxo-2-(1-piperazinyl)ethyl]thio]-6-propyl? |
| A: CAS number of 4(3H)-Pyrimidinone, 2-[[1-methyl-2-oxo-2-(1-piperazinyl)ethyl]thio]-6-propyl is 1303889-67-9. |
| Q: What is the molecular formula of 4(3H)-Pyrimidinone, 2-[[1-methyl-2-oxo-2-(1-piperazinyl)ethyl]thio]-6-propyl? |
| A: Molecular formula of 4(3H)-Pyrimidinone, 2-[[1-methyl-2-oxo-2-(1-piperazinyl)ethyl]thio]-6-propyl is C14H22N4O2S. |
| Q: What is the English name of 4(3H)-Pyrimidinone, 2-[[1-methyl-2-oxo-2-(1-piperazinyl)ethyl]thio]-6-propyl? |
| A: The English name of 4(3H)-Pyrimidinone, 2-[[1-methyl-2-oxo-2-(1-piperazinyl)ethyl]thio]-6-propyl is 4(3H)-Pyrimidinone, 2-[[1-methyl-2-oxo-2-(1-piperazinyl)ethyl]thio]-6-propyl. |
| Q: What is the SMILES notation of 4(3H)-Pyrimidinone, 2-[[1-methyl-2-oxo-2-(1-piperazinyl)ethyl]thio]-6-propyl? |
| A: SMILES notation of 4(3H)-Pyrimidinone, 2-[[1-methyl-2-oxo-2-(1-piperazinyl)ethyl]thio]-6-propyl is CCCc1cc(=O)[nH]c(SC(C)C(=O)N2CCNCC2)n1. |