tert-butyl 3,3-difluoro-4-(hydroxymethyl)piperidine-1-carboxylate structure
|
Common Name | tert-butyl 3,3-difluoro-4-(hydroxymethyl)piperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1303974-47-1 | Molecular Weight | 251.270 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 311.8±42.0 °C at 760 mmHg | |
| Molecular Formula | C11H19F2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.4±27.9 °C | |
| Name | tert-butyl 3,3-difluoro-4-(hydroxymethyl)piperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 311.8±42.0 °C at 760 mmHg |
| Molecular Formula | C11H19F2NO3 |
| Molecular Weight | 251.270 |
| Flash Point | 142.4±27.9 °C |
| Exact Mass | 251.133301 |
| PSA | 49.77000 |
| LogP | 0.85 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.466 |
| InChIKey | GBFXSKJJISVIRA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CO)C(F)(F)C1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Piperidinecarboxylic acid, 3,3-difluoro-4-(hydroxymethyl)-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl 3,3-difluoro-4-(hydroxymethyl)-1-piperidinecarboxylate |