1H-Pyrazol-5-amine, 1-[1-(2-chlorophenyl)ethyl]-4-iodo-3-methyl
Modify Date: 2026-07-24 10:20:08
![1H-Pyrazol-5-amine, 1-[1-(2-chlorophenyl)ethyl]-4-iodo-3-methyl Structure](https://www.chemsrc.com/extcaspic/498/1304635-80-0.png)
1H-Pyrazol-5-amine, 1-[1-(2-chlorophenyl)ethyl]-4-iodo-3-methyl structure
|
Common Name | 1H-Pyrazol-5-amine, 1-[1-(2-chlorophenyl)ethyl]-4-iodo-3-methyl | ||
|---|---|---|---|---|
| CAS Number | 1304635-80-0 | Molecular Weight | 361.61 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13ClIN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1H-Pyrazol-5-amine, 1-[1-(2-chlorophenyl)ethyl]-4-iodo-3-methyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H13ClIN3 |
|---|---|
| Molecular Weight | 361.61 |
| InChIKey | JEBPCCZJHLAXDD-UHFFFAOYSA-N |
| SMILES | Cc1nn(C(C)c2ccccc2Cl)c(N)c1I |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1304635-80-0? |
| A: Chinese name of 1304635-80-0 is 1304635-80-0. |
| Q: What is the molecular formula of 1H-Pyrazol-5-amine, 1-[1-(2-chlorophenyl)ethyl]-4-iodo-3-methyl? |
| A: Molecular formula of 1H-Pyrazol-5-amine, 1-[1-(2-chlorophenyl)ethyl]-4-iodo-3-methyl is C12H13ClIN3. |
| Q: What is the InChIKey of 1H-Pyrazol-5-amine, 1-[1-(2-chlorophenyl)ethyl]-4-iodo-3-methyl? |
| A: InChIKey of 1H-Pyrazol-5-amine, 1-[1-(2-chlorophenyl)ethyl]-4-iodo-3-methyl is JEBPCCZJHLAXDD-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1H-Pyrazol-5-amine, 1-[1-(2-chlorophenyl)ethyl]-4-iodo-3-methyl? |
| A: Molecular weight of 1H-Pyrazol-5-amine, 1-[1-(2-chlorophenyl)ethyl]-4-iodo-3-methyl is 361.61. |
| Q: What is the English name of 1H-Pyrazol-5-amine, 1-[1-(2-chlorophenyl)ethyl]-4-iodo-3-methyl? |
| A: The English name of 1H-Pyrazol-5-amine, 1-[1-(2-chlorophenyl)ethyl]-4-iodo-3-methyl is 1H-Pyrazol-5-amine, 1-[1-(2-chlorophenyl)ethyl]-4-iodo-3-methyl. |
| Q: What is the SMILES notation of 1H-Pyrazol-5-amine, 1-[1-(2-chlorophenyl)ethyl]-4-iodo-3-methyl? |
| A: SMILES notation of 1H-Pyrazol-5-amine, 1-[1-(2-chlorophenyl)ethyl]-4-iodo-3-methyl is Cc1nn(C(C)c2ccccc2Cl)c(N)c1I. |
| Q: What is the CAS number of 1H-Pyrazol-5-amine, 1-[1-(2-chlorophenyl)ethyl]-4-iodo-3-methyl? |
| A: CAS number of 1H-Pyrazol-5-amine, 1-[1-(2-chlorophenyl)ethyl]-4-iodo-3-methyl is 1304635-80-0. |