1,2,2,3,5,6,6-Heptafluoro-7-(trifluoromethyl)-4,8-dioxatricyclo[5.1.0.03,5]octane
Modify Date: 2026-08-14 09:39:29
![1,2,2,3,5,6,6-Heptafluoro-7-(trifluoromethyl)-4,8-dioxatricyclo[5.1.0.03,5]octane Structure](https://www.chemsrc.com/extcaspic/166/130482-35-8.png)
1,2,2,3,5,6,6-Heptafluoro-7-(trifluoromethyl)-4,8-dioxatricyclo[5.1.0.03,5]octane structure
|
Common Name | 1,2,2,3,5,6,6-Heptafluoro-7-(trifluoromethyl)-4,8-dioxatricyclo[5.1.0.03,5]octane | ||
|---|---|---|---|---|
| CAS Number | 130482-35-8 | Molecular Weight | 306.06 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7F10O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2,2,3,5,6,6-Heptafluoro-7-(trifluoromethyl)-4,8-dioxatricyclo[5.1.0.03,5]octane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7F10O2 |
|---|---|
| Molecular Weight | 306.06 |
| InChIKey | NQRAQFXUPHIGAH-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C12OC1(F)C(F)(F)C1(F)OC1(F)C2(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1,2,2,3,5,6,6-Heptafluoro-7-(trifluoromethyl)-4,8-dioxatricyclo[5.1.0.03,5]octane? |
| A: Molecular weight of 1,2,2,3,5,6,6-Heptafluoro-7-(trifluoromethyl)-4,8-dioxatricyclo[5.1.0.03,5]octane is 306.06. |
| Q: What is the English name of 1,2,2,3,5,6,6-Heptafluoro-7-(trifluoromethyl)-4,8-dioxatricyclo[5.1.0.03,5]octane? |
| A: The English name of 1,2,2,3,5,6,6-Heptafluoro-7-(trifluoromethyl)-4,8-dioxatricyclo[5.1.0.03,5]octane is 1,2,2,3,5,6,6-Heptafluoro-7-(trifluoromethyl)-4,8-dioxatricyclo[5.1.0.03,5]octane. |
| Q: What is the CAS number of 1,2,2,3,5,6,6-Heptafluoro-7-(trifluoromethyl)-4,8-dioxatricyclo[5.1.0.03,5]octane? |
| A: CAS number of 1,2,2,3,5,6,6-Heptafluoro-7-(trifluoromethyl)-4,8-dioxatricyclo[5.1.0.03,5]octane is 130482-35-8. |
| Q: What is the Chinese name of 130482-35-8? |
| A: Chinese name of 130482-35-8 is 130482-35-8. |
| Q: What is the SMILES notation of 1,2,2,3,5,6,6-Heptafluoro-7-(trifluoromethyl)-4,8-dioxatricyclo[5.1.0.03,5]octane? |
| A: SMILES notation of 1,2,2,3,5,6,6-Heptafluoro-7-(trifluoromethyl)-4,8-dioxatricyclo[5.1.0.03,5]octane is FC(F)(F)C12OC1(F)C(F)(F)C1(F)OC1(F)C2(F)F. |
| Q: What is the InChIKey of 1,2,2,3,5,6,6-Heptafluoro-7-(trifluoromethyl)-4,8-dioxatricyclo[5.1.0.03,5]octane? |
| A: InChIKey of 1,2,2,3,5,6,6-Heptafluoro-7-(trifluoromethyl)-4,8-dioxatricyclo[5.1.0.03,5]octane is NQRAQFXUPHIGAH-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1,2,2,3,5,6,6-Heptafluoro-7-(trifluoromethyl)-4,8-dioxatricyclo[5.1.0.03,5]octane? |
| A: Molecular formula of 1,2,2,3,5,6,6-Heptafluoro-7-(trifluoromethyl)-4,8-dioxatricyclo[5.1.0.03,5]octane is C7F10O2. |