3H-Pyrazol-3-one,4-bromo-2,4-dihydro-5-(4-methoxyphenyl)-4-methyl- structure
|
Common Name | 3H-Pyrazol-3-one,4-bromo-2,4-dihydro-5-(4-methoxyphenyl)-4-methyl- | ||
|---|---|---|---|---|
| CAS Number | 13051-10-0 | Molecular Weight | 283.12100 | |
| Density | 1.55g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H11BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-bromo-3-(4-methoxyphenyl)-4-methyl-1H-pyrazol-5-one |
|---|
| Density | 1.55g/cm3 |
|---|---|
| Molecular Formula | C11H11BrN2O2 |
| Molecular Weight | 283.12100 |
| Exact Mass | 282.00000 |
| PSA | 50.69000 |
| LogP | 1.44710 |
| Index of Refraction | 1.623 |
| InChIKey | YYQLVPJWNLODRD-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2=NNC(=O)C2(C)Br)cc1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |