Fmoc-L-Thr(beta-D-Glc(Ac)4)-OH
Modify Date: 2025-09-27 15:47:55
Fmoc-L-Thr(beta-D-Glc(Ac)4)-OH structure
|
Common Name | Fmoc-L-Thr(beta-D-Glc(Ac)4)-OH | ||
|---|---|---|---|---|
| CAS Number | 130548-92-4 | Molecular Weight | 671.64500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H37NO14 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | Nα-Fmoc-Thr(Ac4-β-D-Glc)-OH |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C33H37NO14 |
|---|---|
| Molecular Weight | 671.64500 |
| Exact Mass | 671.22100 |
| PSA | 199.29000 |
| LogP | 2.85740 |
| InChIKey | PTSXZIRHPAUPGC-ZJFLVNNCSA-N |
| SMILES | CC(=O)OCC1OC(OC(C)C(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| RIDADR | NONH for all modes of transport |
|---|
|
~%
Fmoc-L-Thr(beta... CAS#:130548-92-4 |
| Literature: Mitchell; Pratt; Hruby; Polt Journal of Organic Chemistry, 2001 , vol. 66, # 7 p. 2327 - 2342 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,3,4,6-tetra-o-acetyl-b-d-glucopyranosyl-fmoc threonine |