N-(2,4-dinitrophenyl)-n-propylamine structure
|
Common Name | N-(2,4-dinitrophenyl)-n-propylamine | ||
|---|---|---|---|---|
| CAS Number | 13059-84-2 | Molecular Weight | 225.20100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2,4-dinitrophenyl)-n-propylamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H11N3O4 |
|---|---|
| Molecular Weight | 225.20100 |
| Exact Mass | 225.07500 |
| PSA | 103.67000 |
| LogP | 3.44430 |
| InChIKey | VTYSAZUSTIWCND-UHFFFAOYSA-N |
| SMILES | CCCNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| HS Code | 2921420090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: Radiosensitizing activity in 4 Gy [60Co] irradiated HT29 cells
Source: ChEMBL
Target: HT-29
External Id: CHEMBL908471
|
|
Name: Cytotoxicity against HT29 cell line without 4 Gy [60Co]-induced irradiation by MTT as...
Source: ChEMBL
Target: HT-29
External Id: CHEMBL908467
|
|
Name: Cytotoxicity against 4 Gy [60Co] irradiated HT29 cell line by MTT assay relative to c...
Source: ChEMBL
Target: HT-29
External Id: CHEMBL908468
|
| .2,4-dinitro-N-propyl-aniline |
| N-(2,4-dinitrophenyl)propylamine |
| .2,4-dinitro-N-n-propylaniline |
| 2,4-DINITRO-N-PROPYLANILINE |
| .2,4-dinitro-N-propylaniline |
| .N-propyl-2,4-dinitrobenzenamine |
| .N-propyl-2,4-dinitroaniline |