Benzenamine,N-butyl-2,4-dinitro- structure
|
Common Name | Benzenamine,N-butyl-2,4-dinitro- | ||
|---|---|---|---|---|
| CAS Number | 13059-86-4 | Molecular Weight | 239.22800 | |
| Density | 1.313g/cm3 | Boiling Point | 384.2ºC at 760 mmHg | |
| Molecular Formula | C10H13N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.1ºC | |
| Name | N-butyl-2,4-dinitro-aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.313g/cm3 |
|---|---|
| Boiling Point | 384.2ºC at 760 mmHg |
| Molecular Formula | C10H13N3O4 |
| Molecular Weight | 239.22800 |
| Flash Point | 186.1ºC |
| Exact Mass | 239.09100 |
| PSA | 103.67000 |
| LogP | 3.83440 |
| Vapour Pressure | 4.17E-06mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | XFLMVRNRVDULNK-UHFFFAOYSA-N |
| SMILES | CCCCNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| HS Code | 2921420090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,4-dinitro-N-butylaniline |