methyl 4-nitrohexanoate structure
|
Common Name | methyl 4-nitrohexanoate | ||
|---|---|---|---|---|
| CAS Number | 13064-28-3 | Molecular Weight | 175.18200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 4-nitrohexanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H13NO4 |
|---|---|
| Molecular Weight | 175.18200 |
| Exact Mass | 175.08400 |
| PSA | 72.12000 |
| LogP | 1.51810 |
| InChIKey | LAGLSZFFUGGYCE-UHFFFAOYSA-N |
| SMILES | CCC(CCC(=O)OC)[N+](=O)[O-] |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| 4-nitro-hexanoic acid methyl ester |
| 4-Nitro-hexansaeure-methylester |