1-(Furan-2-yl)-2-(piperazin-1-yl)ethan-1-one dihydrochloride
Modify Date: 2026-08-22 16:17:08
1-(Furan-2-yl)-2-(piperazin-1-yl)ethan-1-one dihydrochloride structure
|
Common Name | 1-(Furan-2-yl)-2-(piperazin-1-yl)ethan-1-one dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1306604-95-4 | Molecular Weight | 267.15 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H16Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(Furan-2-yl)-2-(piperazin-1-yl)ethan-1-one dihydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H16Cl2N2O2 |
|---|---|
| Molecular Weight | 267.15 |
| InChIKey | UEVMPQYIGOSDKD-UHFFFAOYSA-N |
| SMILES | Cl.Cl.O=C(CN1CCNCC1)c1ccco1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1306604-95-4? |
| A: Chinese name of 1306604-95-4 is 1306604-95-4. |
| Q: What is the molecular weight of 1-(Furan-2-yl)-2-(piperazin-1-yl)ethan-1-one dihydrochloride? |
| A: Molecular weight of 1-(Furan-2-yl)-2-(piperazin-1-yl)ethan-1-one dihydrochloride is 267.15. |
| Q: What is the English name of 1-(Furan-2-yl)-2-(piperazin-1-yl)ethan-1-one dihydrochloride? |
| A: The English name of 1-(Furan-2-yl)-2-(piperazin-1-yl)ethan-1-one dihydrochloride is 1-(Furan-2-yl)-2-(piperazin-1-yl)ethan-1-one dihydrochloride. |
| Q: What is the SMILES notation of 1-(Furan-2-yl)-2-(piperazin-1-yl)ethan-1-one dihydrochloride? |
| A: SMILES notation of 1-(Furan-2-yl)-2-(piperazin-1-yl)ethan-1-one dihydrochloride is Cl.Cl.O=C(CN1CCNCC1)c1ccco1. |
| Q: What is the CAS number of 1-(Furan-2-yl)-2-(piperazin-1-yl)ethan-1-one dihydrochloride? |
| A: CAS number of 1-(Furan-2-yl)-2-(piperazin-1-yl)ethan-1-one dihydrochloride is 1306604-95-4. |
| Q: What is the InChIKey of 1-(Furan-2-yl)-2-(piperazin-1-yl)ethan-1-one dihydrochloride? |
| A: InChIKey of 1-(Furan-2-yl)-2-(piperazin-1-yl)ethan-1-one dihydrochloride is UEVMPQYIGOSDKD-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-(Furan-2-yl)-2-(piperazin-1-yl)ethan-1-one dihydrochloride? |
| A: Molecular formula of 1-(Furan-2-yl)-2-(piperazin-1-yl)ethan-1-one dihydrochloride is C10H16Cl2N2O2. |