1,4-Dioxaspiro[4.5]decan-8-ylmagnesium bromide
Modify Date: 2025-10-02 18:32:32
![1,4-Dioxaspiro[4.5]decan-8-ylmagnesium bromide Structure](https://www.chemsrc.com/extcaspic/093/130669-60-2.png)
1,4-Dioxaspiro[4.5]decan-8-ylmagnesium bromide structure
|
Common Name | 1,4-Dioxaspiro[4.5]decan-8-ylmagnesium bromide | ||
|---|---|---|---|---|
| CAS Number | 130669-60-2 | Molecular Weight | 245.40 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H13BrMgO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,4-Dioxaspiro[4.5]decan-8-ylmagnesium bromide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H13BrMgO2 |
|---|---|
| Molecular Weight | 245.40 |
| InChIKey | YETOVLDHTVUAOO-UHFFFAOYSA-M |
| SMILES | [Br-].[CH-]1CCC2(CC1)OCCO2.[Mg+2] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1,4-Dioxaspiro[4.5]decan-8-ylmagnesium bromide? |
| A: The English name of 1,4-Dioxaspiro[4.5]decan-8-ylmagnesium bromide is 1,4-Dioxaspiro[4.5]decan-8-ylmagnesium bromide. |
| Q: What is the SMILES notation of 1,4-Dioxaspiro[4.5]decan-8-ylmagnesium bromide? |
| A: SMILES notation of 1,4-Dioxaspiro[4.5]decan-8-ylmagnesium bromide is [Br-].[CH-]1CCC2(CC1)OCCO2.[Mg+2]. |
| Q: What is the Chinese name of 130669-60-2? |
| A: Chinese name of 130669-60-2 is 130669-60-2. |
| Q: What is the InChIKey of 1,4-Dioxaspiro[4.5]decan-8-ylmagnesium bromide? |
| A: InChIKey of 1,4-Dioxaspiro[4.5]decan-8-ylmagnesium bromide is YETOVLDHTVUAOO-UHFFFAOYSA-M. |
| Q: What is the molecular formula of 1,4-Dioxaspiro[4.5]decan-8-ylmagnesium bromide? |
| A: Molecular formula of 1,4-Dioxaspiro[4.5]decan-8-ylmagnesium bromide is C8H13BrMgO2. |
| Q: What is the CAS number of 1,4-Dioxaspiro[4.5]decan-8-ylmagnesium bromide? |
| A: CAS number of 1,4-Dioxaspiro[4.5]decan-8-ylmagnesium bromide is 130669-60-2. |
| Q: What is the molecular weight of 1,4-Dioxaspiro[4.5]decan-8-ylmagnesium bromide? |
| A: Molecular weight of 1,4-Dioxaspiro[4.5]decan-8-ylmagnesium bromide is 245.40. |