4-[methoxy(phenyl)phosphinothioyl]oxybenzonitrile structure
|
Common Name | 4-[methoxy(phenyl)phosphinothioyl]oxybenzonitrile | ||
|---|---|---|---|---|
| CAS Number | 13067-96-4 | Molecular Weight | 289.28900 | |
| Density | 1.29g/cm3 | Boiling Point | 411.5ºC at 760 mmHg | |
| Molecular Formula | C14H12NO2PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.6ºC | |
| Name | 4-[methoxy(phenyl)phosphinothioyl]oxybenzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 411.5ºC at 760 mmHg |
| Molecular Formula | C14H12NO2PS |
| Molecular Weight | 289.28900 |
| Flash Point | 202.6ºC |
| Exact Mass | 289.03300 |
| PSA | 84.15000 |
| LogP | 3.86908 |
| Vapour Pressure | 5.58E-07mmHg at 25°C |
| Index of Refraction | 1.615 |
| InChIKey | IPJBVPICLITXIM-UHFFFAOYSA-N |
| SMILES | COP(=S)(Oc1ccc(C#N)cc1)c1ccccc1 |
| Phosphonothioic acid,phenyl-,O-methyl ester,O-ester with p-hydroxybenzonitrile |