2-[(3-amino-2,4,6-triiodophenyl)methyl]pentanedioic acid structure
|
Common Name | 2-[(3-amino-2,4,6-triiodophenyl)methyl]pentanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 13072-72-5 | Molecular Weight | 614.94100 | |
| Density | 2.495g/cm3 | Boiling Point | 620.2ºC at 760mmHg | |
| Molecular Formula | C12H12I3NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 328.9ºC | |
| Name | 2-[(3-amino-2,4,6-triiodophenyl)methyl]pentanedioic acid |
|---|
| Density | 2.495g/cm3 |
|---|---|
| Boiling Point | 620.2ºC at 760mmHg |
| Molecular Formula | C12H12I3NO4 |
| Molecular Weight | 614.94100 |
| Flash Point | 328.9ºC |
| Exact Mass | 614.79000 |
| PSA | 100.62000 |
| LogP | 3.77190 |
| Vapour Pressure | 3.07E-16mmHg at 25°C |
| Index of Refraction | 1.749 |
| InChIKey | KYSLQCGPVCDUGG-UHFFFAOYSA-N |
| SMILES | Nc1c(I)cc(I)c(CC(CCC(=O)O)C(=O)O)c1I |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |