2-Propanesulfonyl chloride, 2-methyl-1-[(2-methylphenyl)amino]-1-oxo
Modify Date: 2026-07-03 18:32:43
![2-Propanesulfonyl chloride, 2-methyl-1-[(2-methylphenyl)amino]-1-oxo Structure](https://www.chemsrc.com/extcaspic/170/1307237-70-2.png)
2-Propanesulfonyl chloride, 2-methyl-1-[(2-methylphenyl)amino]-1-oxo structure
|
Common Name | 2-Propanesulfonyl chloride, 2-methyl-1-[(2-methylphenyl)amino]-1-oxo | ||
|---|---|---|---|---|
| CAS Number | 1307237-70-2 | Molecular Weight | 275.75 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14ClNO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Propanesulfonyl chloride, 2-methyl-1-[(2-methylphenyl)amino]-1-oxo |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H14ClNO3S |
|---|---|
| Molecular Weight | 275.75 |
| InChIKey | AOQQIQFBHVJSTH-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1NC(=O)C(C)(C)S(=O)(=O)Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-Propanesulfonyl chloride, 2-methyl-1-[(2-methylphenyl)amino]-1-oxo? |
| A: InChIKey of 2-Propanesulfonyl chloride, 2-methyl-1-[(2-methylphenyl)amino]-1-oxo is AOQQIQFBHVJSTH-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-Propanesulfonyl chloride, 2-methyl-1-[(2-methylphenyl)amino]-1-oxo? |
| A: CAS number of 2-Propanesulfonyl chloride, 2-methyl-1-[(2-methylphenyl)amino]-1-oxo is 1307237-70-2. |
| Q: What is the English name of 2-Propanesulfonyl chloride, 2-methyl-1-[(2-methylphenyl)amino]-1-oxo? |
| A: The English name of 2-Propanesulfonyl chloride, 2-methyl-1-[(2-methylphenyl)amino]-1-oxo is 2-Propanesulfonyl chloride, 2-methyl-1-[(2-methylphenyl)amino]-1-oxo. |
| Q: What is the molecular weight of 2-Propanesulfonyl chloride, 2-methyl-1-[(2-methylphenyl)amino]-1-oxo? |
| A: Molecular weight of 2-Propanesulfonyl chloride, 2-methyl-1-[(2-methylphenyl)amino]-1-oxo is 275.75. |
| Q: What is the Chinese name of 1307237-70-2? |
| A: Chinese name of 1307237-70-2 is 1307237-70-2. |
| Q: What is the molecular formula of 2-Propanesulfonyl chloride, 2-methyl-1-[(2-methylphenyl)amino]-1-oxo? |
| A: Molecular formula of 2-Propanesulfonyl chloride, 2-methyl-1-[(2-methylphenyl)amino]-1-oxo is C11H14ClNO3S. |
| Q: What is the SMILES notation of 2-Propanesulfonyl chloride, 2-methyl-1-[(2-methylphenyl)amino]-1-oxo? |
| A: SMILES notation of 2-Propanesulfonyl chloride, 2-methyl-1-[(2-methylphenyl)amino]-1-oxo is Cc1ccccc1NC(=O)C(C)(C)S(=O)(=O)Cl. |