Ethanone,2-chloro-1-(4-phenoxyphenyl) structure
|
Common Name | Ethanone,2-chloro-1-(4-phenoxyphenyl) | ||
|---|---|---|---|---|
| CAS Number | 13075-63-3 | Molecular Weight | 246.68900 | |
| Density | 1.215g/cm3 | Boiling Point | 374.4ºC at 760 mmHg | |
| Molecular Formula | C14H11ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.3ºC | |
| Name | 2-chloro-1-(4-phenoxyphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.215g/cm3 |
|---|---|
| Boiling Point | 374.4ºC at 760 mmHg |
| Molecular Formula | C14H11ClO2 |
| Molecular Weight | 246.68900 |
| Flash Point | 154.3ºC |
| Exact Mass | 246.04500 |
| PSA | 26.30000 |
| LogP | 3.90040 |
| Vapour Pressure | 8.4E-06mmHg at 25°C |
| Index of Refraction | 1.58 |
| InChIKey | KXYJNSJYQCRPRE-UHFFFAOYSA-N |
| SMILES | O=C(CCl)c1ccc(Oc2ccccc2)cc1 |
| HS Code | 2914700090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-chloro-1-(4-phenoxy-phenyl)-ethanone |
| 2-Chlor-1-(4-phenoxy-phenyl)-aethanon |
| F9995-0449 |
| 4-phenoxyphenacyl chloride |