Perfluoro-2-Ethyl-2-Methyl-1,3-Dioxole
Modify Date: 2026-07-16 12:18:18
Perfluoro-2-Ethyl-2-Methyl-1,3-Dioxole structure
|
Common Name | Perfluoro-2-Ethyl-2-Methyl-1,3-Dioxole | ||
|---|---|---|---|---|
| CAS Number | 130760-25-7 | Molecular Weight | 294.05 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6F10O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Perfluoro-2-Ethyl-2-Methyl-1,3-Dioxole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6F10O2 |
|---|---|
| Molecular Weight | 294.05 |
| InChIKey | GLTQSUDHSNOUJX-UHFFFAOYSA-N |
| SMILES | FC1=C(F)OC(C(F)(F)F)(C(F)(F)C(F)(F)F)O1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Perfluoro-2-Ethyl-2-Methyl-1,3-Dioxole? |
| A: SMILES notation of Perfluoro-2-Ethyl-2-Methyl-1,3-Dioxole is FC1=C(F)OC(C(F)(F)F)(C(F)(F)C(F)(F)F)O1. |
| Q: What is the English name of Perfluoro-2-Ethyl-2-Methyl-1,3-Dioxole? |
| A: The English name of Perfluoro-2-Ethyl-2-Methyl-1,3-Dioxole is Perfluoro-2-Ethyl-2-Methyl-1,3-Dioxole. |
| Q: What is the Chinese name of 130760-25-7? |
| A: Chinese name of 130760-25-7 is 130760-25-7. |
| Q: What is the CAS number of Perfluoro-2-Ethyl-2-Methyl-1,3-Dioxole? |
| A: CAS number of Perfluoro-2-Ethyl-2-Methyl-1,3-Dioxole is 130760-25-7. |
| Q: What is the molecular formula of Perfluoro-2-Ethyl-2-Methyl-1,3-Dioxole? |
| A: Molecular formula of Perfluoro-2-Ethyl-2-Methyl-1,3-Dioxole is C6F10O2. |
| Q: What is the InChIKey of Perfluoro-2-Ethyl-2-Methyl-1,3-Dioxole? |
| A: InChIKey of Perfluoro-2-Ethyl-2-Methyl-1,3-Dioxole is GLTQSUDHSNOUJX-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Perfluoro-2-Ethyl-2-Methyl-1,3-Dioxole? |
| A: Molecular weight of Perfluoro-2-Ethyl-2-Methyl-1,3-Dioxole is 294.05. |