2-[3-(N-Methylacetylamino)-2,4,6-triiodophenoxy]butyric acid structure
|
Common Name | 2-[3-(N-Methylacetylamino)-2,4,6-triiodophenoxy]butyric acid | ||
|---|---|---|---|---|
| CAS Number | 13080-23-4 | Molecular Weight | 628.96800 | |
| Density | 2.28g/cm3 | Boiling Point | 623.3ºC at 760mmHg | |
| Molecular Formula | C13H14I3NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 330.8ºC | |
| Name | 2-[3-[acetyl(methyl)amino]-2,4,6-triiodophenoxy]butanoic acid |
|---|
| Density | 2.28g/cm3 |
|---|---|
| Boiling Point | 623.3ºC at 760mmHg |
| Molecular Formula | C13H14I3NO4 |
| Molecular Weight | 628.96800 |
| Flash Point | 330.8ºC |
| Exact Mass | 628.80600 |
| PSA | 66.84000 |
| LogP | 3.72510 |
| Vapour Pressure | 2.13E-16mmHg at 25°C |
| Index of Refraction | 1.695 |
| InChIKey | SEPSYIXFWLWAQJ-UHFFFAOYSA-N |
| SMILES | CCC(Oc1c(I)cc(I)c(N(C)C(C)=O)c1I)C(=O)O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |