LHW090-A7
Modify Date: 2025-10-03 23:02:17
LHW090-A7 structure
|
Common Name | LHW090-A7 | ||
|---|---|---|---|---|
| CAS Number | 1308256-94-1 | Molecular Weight | 375.846 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 528.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H22ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.2±30.1 °C | |
Use of LHW090-A7For the detailed information of LHW090-A7, the solubility of LHW090-A7 in water, the solubility of LHW090-A7 in DMSO, the solubility of LHW090-A7 in PBS buffer, the animal experiment (test) of LHW090-A7, the cell expriment (test) of LHW090-A7, the in viv |
| Name | LHW090-A7 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 528.2±50.0 °C at 760 mmHg |
| Molecular Formula | C20H22ClNO4 |
| Molecular Weight | 375.846 |
| Flash Point | 273.2±30.1 °C |
| Exact Mass | 375.123749 |
| LogP | 5.18 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.566 |
| InChIKey | PWYAUIUPDMSWJH-UGSOOPFHSA-N |
| SMILES | CCOC(=O)C(C)NC(Cc1ccc(-c2cccc(Cl)c2)cc1)C(=O)O |
| [1,1'-Biphenyl]-4-propanoic acid, 3'-chloro-α-[[(1S)-2-ethoxy-1-methyl-2-oxoethyl]amino]-, (αS)- |
| 3-(3'-Chloro-4-biphenylyl)-2-[(1-ethoxy-1-oxo-2-propanyl)amino]propanoic acid |
| (2S)-3-(3'-Chloro-4-biphenylyl)-2-{[(2S)-1-ethoxy-1-oxo-2-propanyl]amino}propanoic acid (non-preferred name) |
| (alphaS)-3'-Chloro-alpha-[[(1S)-2-ethoxy-1-methyl-2-oxoethyl]amino][1,1'-biphenyl]-4-propanoic acid |