Phenol,4-[(dimethylamino)methyl]-2-(1,1-dimethylethyl)-6-methyl- structure
|
Common Name | Phenol,4-[(dimethylamino)methyl]-2-(1,1-dimethylethyl)-6-methyl- | ||
|---|---|---|---|---|
| CAS Number | 13086-92-5 | Molecular Weight | 221.33900 | |
| Density | 0.973g/cm3 | Boiling Point | 281.2ºC at 760 mmHg | |
| Molecular Formula | C14H23NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 95.8ºC | |
| Name | 2-tert-butyl-4-[(dimethylamino)methyl]-6-methylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.973g/cm3 |
|---|---|
| Boiling Point | 281.2ºC at 760 mmHg |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.33900 |
| Flash Point | 95.8ºC |
| Exact Mass | 221.17800 |
| PSA | 23.47000 |
| LogP | 3.05970 |
| Vapour Pressure | 0.00212mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | HQWVRCWWPPWWIY-UHFFFAOYSA-N |
| SMILES | Cc1cc(CN(C)C)cc(C(C)(C)C)c1O |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-t-butyl-4-hydroxy-N,N,5-trimethyl-benzylamine |
| N,N-dimethyl-4-aminomethyl-2-methyl-6-t-butylphenol |