3-hydroxymethylaminopyrine structure
|
Common Name | 3-hydroxymethylaminopyrine | ||
|---|---|---|---|---|
| CAS Number | 13097-17-1 | Molecular Weight | 247.29300 | |
| Density | 1.27g/cm3 | Boiling Point | 379.8ºC at 760mmHg | |
| Molecular Formula | C13H17N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.5ºC | |
| Name | 4-(dimethylamino)-5-(hydroxymethyl)-1-methyl-2-phenylpyrazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 379.8ºC at 760mmHg |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.29300 |
| Flash Point | 183.5ºC |
| Exact Mass | 247.13200 |
| PSA | 50.40000 |
| LogP | 0.73430 |
| Vapour Pressure | 1.91E-06mmHg at 25°C |
| Index of Refraction | 1.641 |
| InChIKey | BATBESUQPUOBOC-UHFFFAOYSA-N |
| SMILES | CN(C)c1c(CO)n(C)n(-c2ccccc2)c1=O |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Hydroxymethyl-2-methyl-4-dimethylamino-1-phenyl-3-pyrazol-5-on |
| 3-Hydroxymethylaminopyrine |
| 4-dimethylamino-5-hydroxymethyl-1-methyl-2-phenyl-1,2-dihydro-pyrazol-3-one |
| 4-dimethylamino-3-hydroxymethyl-2-methyl-1-phenyl-3-pyrazolin-5-one |
| 4-Dimethylamino-3-hydroxymethyl-2-methyl-2-phenyl-3pyrazolin-5-one |