3-(3,4-Dihydro-2,4-dioxo-1(2h)-quinazolinyl)benzoic acid methyl ester structure
|
Common Name | 3-(3,4-Dihydro-2,4-dioxo-1(2h)-quinazolinyl)benzoic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 130985-16-9 | Molecular Weight | 296.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(3,4-Dihydro-2,4-dioxo-1(2h)-quinazolinyl)benzoic acid methyl ester |
|---|
| Molecular Formula | C16H12N2O4 |
|---|---|
| Molecular Weight | 296.28 |
| InChIKey | GOUWLELLHQRVOH-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cccc(-n2c(=O)[nH]c(=O)c3ccccc32)c1 |
|
Name: Percentage inhibition of carrageenan-induced rat foot edema at a dose of 32 mg/kg whe...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL790805
|
|
Name: Inhibition of reserpine-induced hypothermia in mice by peroral dose
Source: ChEMBL
Target: Mus musculus
External Id: CHEMBL723178
|