2-Bromo-5-(tert-butoxy)-1,3-dimethylbenzene
Modify Date: 2026-07-06 20:09:06
2-Bromo-5-(tert-butoxy)-1,3-dimethylbenzene structure
|
Common Name | 2-Bromo-5-(tert-butoxy)-1,3-dimethylbenzene | ||
|---|---|---|---|---|
| CAS Number | 1309933-29-6 | Molecular Weight | 257.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H17BrO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Bromo-5-(tert-butoxy)-1,3-dimethylbenzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H17BrO |
|---|---|
| Molecular Weight | 257.17 |
| InChIKey | FVBWZOGNIOHGEC-UHFFFAOYSA-N |
| SMILES | Cc1cc(OC(C)(C)C)cc(C)c1Br |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-Bromo-5-(tert-butoxy)-1,3-dimethylbenzene? |
| A: CAS number of 2-Bromo-5-(tert-butoxy)-1,3-dimethylbenzene is 1309933-29-6. |
| Q: What is the molecular formula of 2-Bromo-5-(tert-butoxy)-1,3-dimethylbenzene? |
| A: Molecular formula of 2-Bromo-5-(tert-butoxy)-1,3-dimethylbenzene is C12H17BrO. |
| Q: What is the Chinese name of 1309933-29-6? |
| A: Chinese name of 1309933-29-6 is 1309933-29-6. |
| Q: What is the English name of 2-Bromo-5-(tert-butoxy)-1,3-dimethylbenzene? |
| A: The English name of 2-Bromo-5-(tert-butoxy)-1,3-dimethylbenzene is 2-Bromo-5-(tert-butoxy)-1,3-dimethylbenzene. |
| Q: What is the InChIKey of 2-Bromo-5-(tert-butoxy)-1,3-dimethylbenzene? |
| A: InChIKey of 2-Bromo-5-(tert-butoxy)-1,3-dimethylbenzene is FVBWZOGNIOHGEC-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-Bromo-5-(tert-butoxy)-1,3-dimethylbenzene? |
| A: SMILES notation of 2-Bromo-5-(tert-butoxy)-1,3-dimethylbenzene is Cc1cc(OC(C)(C)C)cc(C)c1Br. |
| Q: What is the molecular weight of 2-Bromo-5-(tert-butoxy)-1,3-dimethylbenzene? |
| A: Molecular weight of 2-Bromo-5-(tert-butoxy)-1,3-dimethylbenzene is 257.17. |