5-Bromo-2-(tert-butoxy)-1,3-difluorobenzene
Modify Date: 2025-09-09 16:53:03
5-Bromo-2-(tert-butoxy)-1,3-difluorobenzene structure
|
Common Name | 5-Bromo-2-(tert-butoxy)-1,3-difluorobenzene | ||
|---|---|---|---|---|
| CAS Number | 1309933-86-5 | Molecular Weight | 265.09 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11BrF2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Bromo-2-(tert-butoxy)-1,3-difluorobenzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H11BrF2O |
|---|---|
| Molecular Weight | 265.09 |
| InChIKey | WVILRHQREWIAON-UHFFFAOYSA-N |
| SMILES | CC(C)(C)Oc1c(F)cc(Br)cc1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 5-Bromo-2-(tert-butoxy)-1,3-difluorobenzene? |
| A: The English name of 5-Bromo-2-(tert-butoxy)-1,3-difluorobenzene is 5-Bromo-2-(tert-butoxy)-1,3-difluorobenzene. |
| Q: What is the CAS number of 5-Bromo-2-(tert-butoxy)-1,3-difluorobenzene? |
| A: CAS number of 5-Bromo-2-(tert-butoxy)-1,3-difluorobenzene is 1309933-86-5. |
| Q: What is the SMILES notation of 5-Bromo-2-(tert-butoxy)-1,3-difluorobenzene? |
| A: SMILES notation of 5-Bromo-2-(tert-butoxy)-1,3-difluorobenzene is CC(C)(C)Oc1c(F)cc(Br)cc1F. |
| Q: What is the molecular formula of 5-Bromo-2-(tert-butoxy)-1,3-difluorobenzene? |
| A: Molecular formula of 5-Bromo-2-(tert-butoxy)-1,3-difluorobenzene is C10H11BrF2O. |
| Q: What is the molecular weight of 5-Bromo-2-(tert-butoxy)-1,3-difluorobenzene? |
| A: Molecular weight of 5-Bromo-2-(tert-butoxy)-1,3-difluorobenzene is 265.09. |
| Q: What is the InChIKey of 5-Bromo-2-(tert-butoxy)-1,3-difluorobenzene? |
| A: InChIKey of 5-Bromo-2-(tert-butoxy)-1,3-difluorobenzene is WVILRHQREWIAON-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1309933-86-5? |
| A: Chinese name of 1309933-86-5 is 1309933-86-5. |