Phthalylsulfacetamide structure
|
Common Name | Phthalylsulfacetamide | ||
|---|---|---|---|---|
| CAS Number | 131-69-1 | Molecular Weight | 362.35700 | |
| Density | 1.478 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H14N2O6S | Melting Point | 196° | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of PhthalylsulfacetamidePhthalylsulfacetamide is a sulfa drug, after oral administration, slowly decompose in the intestine,and release sulfacetamide ,generating antibacterial effect. |
| Name | 2-[[4-(acetylsulfamoyl)phenyl]carbamoyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Phthalylsulfacetamide is a sulfa drug, after oral administration, slowly decompose in the intestine,and release sulfacetamide ,generating antibacterial effect. |
|---|---|
| Related Catalog |
| Density | 1.478 g/cm3 |
|---|---|
| Melting Point | 196° |
| Molecular Formula | C16H14N2O6S |
| Molecular Weight | 362.35700 |
| Exact Mass | 362.05700 |
| PSA | 138.02000 |
| LogP | 3.00660 |
| Index of Refraction | 1.637 |
| InChIKey | SNWQKAWITMVCQW-UHFFFAOYSA-N |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(NC(=O)c2ccccc2C(=O)O)cc1 |
| Storage condition | 2-8℃ |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | UN 3249 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 2935009090 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| Phthalylsulfacetamide |
| 4'-(acetylsulfamoyl)-phthalanilic acid |
| N-(4-acetylsulfamoyl-phenyl)-phthalamic acid |
| Phthalylsulphacetamide |
| EINECS 205-035-7 |
| Talicetimida |
| Enterosulphamid |
| Enterosulfon |
| Phthalylsulfanilacetamid |
| Tamid |
| N-(4-Acetylsulfamoyl-phenyl)-phthalamidsaeure |
| MFCD00020275 |
| Ftalicetimida |
| Enterosulfamid |
| Enterocid |
| Kalacet |