uridine 2'-monophosphate structure
|
Common Name | uridine 2'-monophosphate | ||
|---|---|---|---|---|
| CAS Number | 131-83-9 | Molecular Weight | 324.18100 | |
| Density | 1.88g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H13N2O9P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | uridine 2'-phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.88g/cm3 |
|---|---|
| Molecular Formula | C9H13N2O9P |
| Molecular Weight | 324.18100 |
| Exact Mass | 324.03600 |
| PSA | 181.38000 |
| Index of Refraction | 1.659 |
| InChIKey | HQIDPEYTETUCNF-XVFCMESISA-N |
| SMILES | O=c1ccn(C2OC(CO)C(O)C2OP(=O)(O)O)c(=O)[nH]1 |
|
Name: Experimentally measured binding affinity data (Ki) for protein-ligand complexes deriv...
Source: Shanghai Institute of Organic Chemistry
Target: N/A
External Id: PDBbind-Ki for protein-ligand complexes
|
| 2'-Uridylate |
| U2P |
| [(2R,3R,4R,5R)-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate |
| EINECS 205-040-4 |
| 2'-Phosphouridine |
| uridine 2'-monophosphate |
| Uridine 2'-phosphate |
| 2'-UMP |