(+/-)-Bisoprolol-D7 hemifumarate
Modify Date: 2025-09-09 16:57:13
(+/-)-Bisoprolol-D7 hemifumarate structure
|
Common Name | (+/-)-Bisoprolol-D7 hemifumarate | ||
|---|---|---|---|---|
| CAS Number | 1310012-17-9 | Molecular Weight | 781.0 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C40H66N2O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (+/-)-Bisoprolol-D7 hemifumarate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C40H66N2O12 |
|---|---|
| Molecular Weight | 781.0 |
| InChIKey | VMDFASMUILANOL-QNEOGBJYSA-N |
| SMILES | CC(C)NCC(O)COc1ccc(COCCOC(C)C)cc1.CC(C)NCC(O)COc1ccc(COCCOC(C)C)cc1.O=C(O)C=CC(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (+/-)-Bisoprolol-D7 hemifumarate? |
| A: Molecular weight of (+/-)-Bisoprolol-D7 hemifumarate is 781.0. |
| Q: What is the InChIKey of (+/-)-Bisoprolol-D7 hemifumarate? |
| A: InChIKey of (+/-)-Bisoprolol-D7 hemifumarate is VMDFASMUILANOL-QNEOGBJYSA-N. |
| Q: What is the SMILES notation of (+/-)-Bisoprolol-D7 hemifumarate? |
| A: SMILES notation of (+/-)-Bisoprolol-D7 hemifumarate is CC(C)NCC(O)COc1ccc(COCCOC(C)C)cc1.CC(C)NCC(O)COc1ccc(COCCOC(C)C)cc1.O=C(O)C=CC(=O)O. |
| Q: What is the CAS number of (+/-)-Bisoprolol-D7 hemifumarate? |
| A: CAS number of (+/-)-Bisoprolol-D7 hemifumarate is 1310012-17-9. |
| Q: What is the molecular formula of (+/-)-Bisoprolol-D7 hemifumarate? |
| A: Molecular formula of (+/-)-Bisoprolol-D7 hemifumarate is C40H66N2O12. |
| Q: What is the English name of (+/-)-Bisoprolol-D7 hemifumarate? |
| A: The English name of (+/-)-Bisoprolol-D7 hemifumarate is (+/-)-Bisoprolol-D7 hemifumarate. |
| Q: What is the Chinese name of 1310012-17-9? |
| A: Chinese name of 1310012-17-9 is 1310012-17-9. |