BACE1-IN-1 structure
|
Common Name | BACE1-IN-1 | ||
|---|---|---|---|---|
| CAS Number | 1310347-50-2 | Molecular Weight | 389.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H14F3N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BACE1-IN-1BACE1-IN-1 is a potent and highly brain penetrant BACE1 inhibitor with IC50s of 32 and 47 nM for human BACE1 and BACE2, respectively. |
| Name | BACE1-IN-1 |
|---|
| Description | BACE1-IN-1 is a potent and highly brain penetrant BACE1 inhibitor with IC50s of 32 and 47 nM for human BACE1 and BACE2, respectively. |
|---|---|
| Related Catalog | |
| Target |
IC50: 32 nM (human BACE1), 47 nM (human BACE2)[1] |
| References |
| Molecular Formula | C18H14F3N5O2 |
|---|---|
| Molecular Weight | 389.33 |
| InChIKey | DVMUZHLUMHPCGZ-QGZVFWFLSA-N |
| SMILES | CC1(c2cc(NC(=O)c3ccc(C#N)cn3)ccc2F)N=C(N)OCC1(F)F |
| Storage condition | 2-8℃ |