(1-(tert-Butoxycarbonyl)-5,6-dichloro-1H-indol-2-yl)boronic acid structure
|
Common Name | (1-(tert-Butoxycarbonyl)-5,6-dichloro-1H-indol-2-yl)boronic acid | ||
|---|---|---|---|---|
| CAS Number | 1310384-28-1 | Molecular Weight | 329.972 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 499.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C13H14BCl2NO4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 255.8±31.5 °C | |
| Name | [5,6-dichloro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 499.4±55.0 °C at 760 mmHg |
| Molecular Formula | C13H14BCl2NO4 |
| Molecular Weight | 329.972 |
| Flash Point | 255.8±31.5 °C |
| Exact Mass | 329.039307 |
| PSA | 71.69000 |
| LogP | 4.30 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.574 |
| InChIKey | BRRPGLYHNRRPNX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)n1c(B(O)O)cc2cc(Cl)c(Cl)cc21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| X9783 |
| [1-(tert-Butoxycarbonyl)-5,6-dichloro-1H-indol-2-yl]boronic acid |
| (5,6-Dichloro-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-1H-indol-2-yl)boronic acid |
| 1H-Indole-1-carboxylic acid, 2-borono-5,6-dichloro-, 1,1-dimethylethyl ester |
| 1-Boc-5,6-Dichloro-1H-indole-2-boronic acid |