[5-bromo-2-chloro-3-(trifluoromethyl)phenyl]boronic acid structure
|
Common Name | [5-bromo-2-chloro-3-(trifluoromethyl)phenyl]boronic acid | ||
|---|---|---|---|---|
| CAS Number | 1310403-90-7 | Molecular Weight | 303.26900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H4BBrClF3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [5-bromo-2-chloro-3-(trifluoromethyl)phenyl]boronic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H4BBrClF3O2 |
|---|---|
| Molecular Weight | 303.26900 |
| Exact Mass | 301.91300 |
| PSA | 40.46000 |
| LogP | 1.80110 |
| InChIKey | PAQZALHPMXHSTK-UHFFFAOYSA-N |
| SMILES | OB(O)c1cc(Br)cc(C(F)(F)F)c1Cl |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| I04-0801 |
| 5-bromo-2-chloro-3-(trifluoromethyl)phenylboronic acid |
| I04-0802 |