Carbonic acid, 2-a[(benzoyldioxy)acarbonyl]aphenyl 1-amethylethyl ester
Modify Date: 2026-08-23 17:37:24
![Carbonic acid, 2-a[(benzoyldioxy)acarbonyl]aphenyl 1-amethylethyl ester Structure](https://www.chemsrc.com/extcaspic/279/1310672-91-3.png)
Carbonic acid, 2-a[(benzoyldioxy)acarbonyl]aphenyl 1-amethylethyl ester structure
|
Common Name | Carbonic acid, 2-a[(benzoyldioxy)acarbonyl]aphenyl 1-amethylethyl ester | ||
|---|---|---|---|---|
| CAS Number | 1310672-91-3 | Molecular Weight | 344.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H16O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Carbonic acid, 2-a[(benzoyldioxy)acarbonyl]aphenyl 1-amethylethyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H16O7 |
|---|---|
| Molecular Weight | 344.3 |
| InChIKey | BBIBHXJTVUHJED-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)Oc1ccccc1C(=O)OOC(=O)c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Carbonic acid, 2-a[(benzoyldioxy)acarbonyl]aphenyl 1-amethylethyl ester? |
| A: CAS number of Carbonic acid, 2-a[(benzoyldioxy)acarbonyl]aphenyl 1-amethylethyl ester is 1310672-91-3. |
| Q: What is the molecular formula of Carbonic acid, 2-a[(benzoyldioxy)acarbonyl]aphenyl 1-amethylethyl ester? |
| A: Molecular formula of Carbonic acid, 2-a[(benzoyldioxy)acarbonyl]aphenyl 1-amethylethyl ester is C18H16O7. |
| Q: What is the InChIKey of Carbonic acid, 2-a[(benzoyldioxy)acarbonyl]aphenyl 1-amethylethyl ester? |
| A: InChIKey of Carbonic acid, 2-a[(benzoyldioxy)acarbonyl]aphenyl 1-amethylethyl ester is BBIBHXJTVUHJED-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Carbonic acid, 2-a[(benzoyldioxy)acarbonyl]aphenyl 1-amethylethyl ester? |
| A: Molecular weight of Carbonic acid, 2-a[(benzoyldioxy)acarbonyl]aphenyl 1-amethylethyl ester is 344.3. |
| Q: What is the Chinese name of 1310672-91-3? |
| A: Chinese name of 1310672-91-3 is 1310672-91-3. |
| Q: What is the SMILES notation of Carbonic acid, 2-a[(benzoyldioxy)acarbonyl]aphenyl 1-amethylethyl ester? |
| A: SMILES notation of Carbonic acid, 2-a[(benzoyldioxy)acarbonyl]aphenyl 1-amethylethyl ester is CC(C)OC(=O)Oc1ccccc1C(=O)OOC(=O)c1ccccc1. |
| Q: What is the English name of Carbonic acid, 2-a[(benzoyldioxy)acarbonyl]aphenyl 1-amethylethyl ester? |
| A: The English name of Carbonic acid, 2-a[(benzoyldioxy)acarbonyl]aphenyl 1-amethylethyl ester is Carbonic acid, 2-a[(benzoyldioxy)acarbonyl]aphenyl 1-amethylethyl ester. |