N-{8-cyano-1,4-dioxaspiro[4.5]decan-8-yl}-3-(2,4-dimethylphenyl)propanamide
Modify Date: 2025-08-26 21:59:14
![N-{8-cyano-1,4-dioxaspiro[4.5]decan-8-yl}-3-(2,4-dimethylphenyl)propanamide Structure](https://www.chemsrc.com/extcaspic/422/1311976-30-3.png)
N-{8-cyano-1,4-dioxaspiro[4.5]decan-8-yl}-3-(2,4-dimethylphenyl)propanamide structure
|
Common Name | N-{8-cyano-1,4-dioxaspiro[4.5]decan-8-yl}-3-(2,4-dimethylphenyl)propanamide | ||
|---|---|---|---|---|
| CAS Number | 1311976-30-3 | Molecular Weight | 342.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H26N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-{8-cyano-1,4-dioxaspiro[4.5]decan-8-yl}-3-(2,4-dimethylphenyl)propanamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H26N2O3 |
|---|---|
| Molecular Weight | 342.4 |
| InChIKey | WXNLYGKKECOCGG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(CCC(=O)NC2(C#N)CCC3(CC2)OCCO3)c(C)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N-{8-cyano-1,4-dioxaspiro[4.5]decan-8-yl}-3-(2,4-dimethylphenyl)propanamide? |
| A: The English name of N-{8-cyano-1,4-dioxaspiro[4.5]decan-8-yl}-3-(2,4-dimethylphenyl)propanamide is N-{8-cyano-1,4-dioxaspiro[4.5]decan-8-yl}-3-(2,4-dimethylphenyl)propanamide. |
| Q: What is the molecular weight of N-{8-cyano-1,4-dioxaspiro[4.5]decan-8-yl}-3-(2,4-dimethylphenyl)propanamide? |
| A: Molecular weight of N-{8-cyano-1,4-dioxaspiro[4.5]decan-8-yl}-3-(2,4-dimethylphenyl)propanamide is 342.4. |
| Q: What is the InChIKey of N-{8-cyano-1,4-dioxaspiro[4.5]decan-8-yl}-3-(2,4-dimethylphenyl)propanamide? |
| A: InChIKey of N-{8-cyano-1,4-dioxaspiro[4.5]decan-8-yl}-3-(2,4-dimethylphenyl)propanamide is WXNLYGKKECOCGG-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N-{8-cyano-1,4-dioxaspiro[4.5]decan-8-yl}-3-(2,4-dimethylphenyl)propanamide? |
| A: Molecular formula of N-{8-cyano-1,4-dioxaspiro[4.5]decan-8-yl}-3-(2,4-dimethylphenyl)propanamide is C20H26N2O3. |
| Q: What is the Chinese name of 1311976-30-3? |
| A: Chinese name of 1311976-30-3 is 1311976-30-3. |
| Q: What is the SMILES notation of N-{8-cyano-1,4-dioxaspiro[4.5]decan-8-yl}-3-(2,4-dimethylphenyl)propanamide? |
| A: SMILES notation of N-{8-cyano-1,4-dioxaspiro[4.5]decan-8-yl}-3-(2,4-dimethylphenyl)propanamide is Cc1ccc(CCC(=O)NC2(C#N)CCC3(CC2)OCCO3)c(C)c1. |
| Q: What is the CAS number of N-{8-cyano-1,4-dioxaspiro[4.5]decan-8-yl}-3-(2,4-dimethylphenyl)propanamide? |
| A: CAS number of N-{8-cyano-1,4-dioxaspiro[4.5]decan-8-yl}-3-(2,4-dimethylphenyl)propanamide is 1311976-30-3. |