H-Val-Thr-Cys-Gly-OH structure
|
Common Name | H-Val-Thr-Cys-Gly-OH | ||
|---|---|---|---|---|
| CAS Number | 131204-46-1 | Molecular Weight | 378.44400 | |
| Density | 1.308g/cm3 | Boiling Point | 787.9ºC at 760 mmHg | |
| Molecular Formula | C14H26N4O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 430.3ºC | |
Use of H-Val-Thr-Cys-Gly-OHH-Val-Thr-Cys-Gly-OH is a cell attachment peptide. H-Val-Thr-Cys-Gly-OH is a bioactive molecule used for cell adhesion or other cell interactions[1]. |
| Name | 2-[[2-[[2-[(2-amino-3-methylbutanoyl)amino]-3-hydroxybutanoyl]amino]-3-sulfanylpropanoyl]amino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Description | H-Val-Thr-Cys-Gly-OH is a cell attachment peptide. H-Val-Thr-Cys-Gly-OH is a bioactive molecule used for cell adhesion or other cell interactions[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Rauh F, et, al. Method and systems for using biopolymer-based beads and hydrogels. WO2007147014. |
| Density | 1.308g/cm3 |
|---|---|
| Boiling Point | 787.9ºC at 760 mmHg |
| Molecular Formula | C14H26N4O6S |
| Molecular Weight | 378.44400 |
| Flash Point | 430.3ºC |
| Exact Mass | 378.15700 |
| PSA | 209.65000 |
| Vapour Pressure | 1.08E-28mmHg at 25°C |
| Index of Refraction | 1.549 |
| InChIKey | PWFIBKCXTPLSHX-IFFSRLJSSA-N |
| SMILES | CC(C)C(N)C(=O)NC(C(=O)NC(CS)C(=O)NCC(=O)O)C(C)O |
| Val-Thr-Cys-Gly |