tagatosazine structure
|
Common Name | tagatosazine | ||
|---|---|---|---|---|
| CAS Number | 13121-64-7 | Molecular Weight | 320.29600 | |
| Density | 1.68g/cm3 | Boiling Point | 764.9ºC at 760mmHg | |
| Molecular Formula | C12H20N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 416.4ºC | |
| Name | (1R,2R,3R,1'R,2'R,3'R)-1,1'-(2,5-Pyrazinediyl)di(1,2,3,4-butanete trol) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.68g/cm3 |
|---|---|
| Boiling Point | 764.9ºC at 760mmHg |
| Molecular Formula | C12H20N2O8 |
| Molecular Weight | 320.29600 |
| Flash Point | 416.4ºC |
| Exact Mass | 320.12200 |
| PSA | 187.62000 |
| Vapour Pressure | 1.34E-24mmHg at 25°C |
| Index of Refraction | 1.681 |
| InChIKey | NPWQIVOYGNUVEB-JKCCIXDMSA-N |
| SMILES | OCC(O)C(O)C(O)c1cnc(C(O)C(O)C(O)CO)cn1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Benzoxazole,2,2'-(2,5-thiophenediyl)bis[5-methyl |
| tagatosazine |
| 2,5-Bis-<5'-methylbenzoxazolyl(2')>-thiophene |
| (Tagatosazin) |
| 5,5'-dimethyl-2,2'-thiophene-2,5-diyl-bis-benzooxazole |
| bis-(1R,1'R,2R,2'R,3R,3'R)-1,2,3,4-butanetetrol-1,1'-(2,5-pyrazinediyl) |
| 2,5-Bis-(D-lyxo-tetrahydroxy-butyl)-pyrazin |