Cbz-Phe-Gly-OH structure
|
Common Name | Cbz-Phe-Gly-OH | ||
|---|---|---|---|---|
| CAS Number | 13122-99-1 | Molecular Weight | 356.37300 | |
| Density | 1.278g/cm3 | Boiling Point | 669.9ºC at 760mmHg | |
| Molecular Formula | C19H20N2O5 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 358.9ºC | |
| Name | z-phe-gly-oh |
|---|---|
| Synonym | More Synonyms |
| Density | 1.278g/cm3 |
|---|---|
| Boiling Point | 669.9ºC at 760mmHg |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.37300 |
| Flash Point | 358.9ºC |
| Exact Mass | 356.13700 |
| PSA | 104.73000 |
| LogP | 2.50670 |
| Vapour Pressure | 7.37E-19mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | OEIUAJRTESSOCC-INIZCTEOSA-N |
| SMILES | O=C(O)CNC(=O)C(Cc1ccccc1)NC(=O)OCc1ccccc1 |
| Storage condition | -20℃ |
| RIDADR | NONH for all modes of transport |
|---|---|
| WGK Germany | 3 |
| HS Code | 2924299090 |
| Precursor 9 | |
|---|---|
| DownStream 5 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Virus replication inhibitory peptide inhibits the conversion of phospholipid bilayers to the hexagonal phase.
Biosci. Rep. 6(7) , 647-53, (1986) Virus replication inhibitory peptide (carbobenzoxy-D-Phe-L-PheGly) was shown to be a potent specific inhibitor of the replication of paramyxovirus and myxovirus (Richardson, Scheid and Choppin (1980),... |
| N-CBZ-PHE-GLY |
| Cbz-Phe-Gly-OH |
| Cbz-L-Phe-Gly-OH |
| CBZ-L-PHE GLY |
| Z-L-Phe-Gly-OH |
| N-benzyloxycarbonyl-L-phenylalanyl-glycine |
| N-Cbz-L-Phe-Gly-OH |
| N-Cbz-Phe-GlyOH |
| Z-PHE-GLY |
| N-carbobenzyloxy-Phe-Gly |
| Einecs 236-052-8 |