Methanone, [(2R)-2-(2-oxiranylmethoxy)-3-phenyl-2-pyrrolidinyl]phenyl
Modify Date: 2026-07-27 19:12:26
![Methanone, [(2R)-2-(2-oxiranylmethoxy)-3-phenyl-2-pyrrolidinyl]phenyl Structure](https://www.chemsrc.com/extcaspic/259/1312716-31-6.png)
Methanone, [(2R)-2-(2-oxiranylmethoxy)-3-phenyl-2-pyrrolidinyl]phenyl structure
|
Common Name | Methanone, [(2R)-2-(2-oxiranylmethoxy)-3-phenyl-2-pyrrolidinyl]phenyl | ||
|---|---|---|---|---|
| CAS Number | 1312716-31-6 | Molecular Weight | 323.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methanone, [(2R)-2-(2-oxiranylmethoxy)-3-phenyl-2-pyrrolidinyl]phenyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H21NO3 |
|---|---|
| Molecular Weight | 323.4 |
| InChIKey | QMFCPWCWOBYHCD-AFMYVXGZSA-N |
| SMILES | O=C(c1ccccc1)C1(OCC2CO2)NCCC1c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Methanone, [(2R)-2-(2-oxiranylmethoxy)-3-phenyl-2-pyrrolidinyl]phenyl? |
| A: Molecular formula of Methanone, [(2R)-2-(2-oxiranylmethoxy)-3-phenyl-2-pyrrolidinyl]phenyl is C20H21NO3. |
| Q: What is the Chinese name of 1312716-31-6? |
| A: Chinese name of 1312716-31-6 is 1312716-31-6. |
| Q: What is the InChIKey of Methanone, [(2R)-2-(2-oxiranylmethoxy)-3-phenyl-2-pyrrolidinyl]phenyl? |
| A: InChIKey of Methanone, [(2R)-2-(2-oxiranylmethoxy)-3-phenyl-2-pyrrolidinyl]phenyl is QMFCPWCWOBYHCD-AFMYVXGZSA-N. |
| Q: What is the molecular weight of Methanone, [(2R)-2-(2-oxiranylmethoxy)-3-phenyl-2-pyrrolidinyl]phenyl? |
| A: Molecular weight of Methanone, [(2R)-2-(2-oxiranylmethoxy)-3-phenyl-2-pyrrolidinyl]phenyl is 323.4. |
| Q: What is the CAS number of Methanone, [(2R)-2-(2-oxiranylmethoxy)-3-phenyl-2-pyrrolidinyl]phenyl? |
| A: CAS number of Methanone, [(2R)-2-(2-oxiranylmethoxy)-3-phenyl-2-pyrrolidinyl]phenyl is 1312716-31-6. |
| Q: What is the English name of Methanone, [(2R)-2-(2-oxiranylmethoxy)-3-phenyl-2-pyrrolidinyl]phenyl? |
| A: The English name of Methanone, [(2R)-2-(2-oxiranylmethoxy)-3-phenyl-2-pyrrolidinyl]phenyl is Methanone, [(2R)-2-(2-oxiranylmethoxy)-3-phenyl-2-pyrrolidinyl]phenyl. |
| Q: What is the SMILES notation of Methanone, [(2R)-2-(2-oxiranylmethoxy)-3-phenyl-2-pyrrolidinyl]phenyl? |
| A: SMILES notation of Methanone, [(2R)-2-(2-oxiranylmethoxy)-3-phenyl-2-pyrrolidinyl]phenyl is O=C(c1ccccc1)C1(OCC2CO2)NCCC1c1ccccc1. |