4-(4-(Prop-2-yn-1-yloxy)phenyl)-1,2,4-triazolidine-3,5-dione structure
|
Common Name | 4-(4-(Prop-2-yn-1-yloxy)phenyl)-1,2,4-triazolidine-3,5-dione | ||
|---|---|---|---|---|
| CAS Number | 1313211-51-6 | Molecular Weight | 231.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9N3O3 | Melting Point | 176-181°C | |
| MSDS | USA | Flash Point | N/A | |
| Name | 4-(4-(Prop-2-yn-1-yloxy)phenyl)-1,2,4-triazolidine-3,5-dione |
|---|
| Melting Point | 176-181°C |
|---|---|
| Molecular Formula | C11H9N3O3 |
| Molecular Weight | 231.21 |
| InChIKey | IHJYYZNVZZKSCU-UHFFFAOYSA-N |
| SMILES | C#CCOc1ccc(-n2c(=O)[nH][nH]c2=O)cc1 |
| Storage condition | 2-8°C |
| RIDADR | NONH for all modes of transport |
|---|---|
| WGK Germany | 3 |
|
Facile and stabile linkages through tyrosine: bioconjugation strategies with the tyrosine-click reaction.
Bioconjug. Chem. 24(4) , 520-532, (2013) The scope, chemoselectivity, and utility of the click-like tyrosine labeling reaction with 4-phenyl-3H-1,2,4-triazoline-3,5(4H)-diones (PTADs) is reported. To study the utility and chemoselectivity of... |