4,4-Difluoroadamantan-1-carboxylic acid Methyl ester
Modify Date: 2025-09-19 08:35:34
4,4-Difluoroadamantan-1-carboxylic acid Methyl ester structure
|
Common Name | 4,4-Difluoroadamantan-1-carboxylic acid Methyl ester | ||
|---|---|---|---|---|
| CAS Number | 1313739-04-6 | Molecular Weight | 230.25100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16F2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,4-Difluoroadamantane-1-carboxylic acid methyl ester |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H16F2O2 |
|---|---|
| Molecular Weight | 230.25100 |
| Exact Mass | 230.11200 |
| PSA | 26.30000 |
| LogP | 2.62100 |
| InChIKey | IRSQDTPPCWEWKW-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CC3CC(C1)C(F)(F)C(C3)C2 |
| HS Code | 2916209090 |
|---|
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| methyl 4,4-difluoroadamantane-1-carboxylate |