ethyl 4-(3-oxocyclohexyl)benzoate structure
|
Common Name | ethyl 4-(3-oxocyclohexyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 131379-22-1 | Molecular Weight | 246.30200 | |
| Density | 1.112g/cm3 | Boiling Point | 384.091ºC at 760 mmHg | |
| Molecular Formula | C15H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.712ºC | |
| Name | ethyl 4-(3-oxocyclohexyl)benzoate |
|---|
| Density | 1.112g/cm3 |
|---|---|
| Boiling Point | 384.091ºC at 760 mmHg |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.30200 |
| Flash Point | 169.712ºC |
| Exact Mass | 246.12600 |
| PSA | 43.37000 |
| LogP | 3.09000 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.532 |
| InChIKey | COZQEZKXAYCLIS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(C2CCCC(=O)C2)cc1 |
| HS Code | 2918300090 |
|---|
|
~71%
ethyl 4-(3-oxoc... CAS#:131379-22-1 |
| Literature: Piazza, Claudia; Knochel, Paul Angewandte Chemie - International Edition, 2002 , vol. 41, # 17 p. 3263 - 3265 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |